C30H35N5OS — CID 139298265
N-[3-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]prop-2-ynyl]cyclohexanamine (PubChem CID 139298265) has the molecular formula C30H35N5OS and a molecular weight of 513.71 g/mol. Its IUPAC name is N-[3-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]prop-2-ynyl]cyclohexanamine.
| Compound Name | N-[3-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]prop-2-ynyl]cyclohexanamine |
|---|---|
| PubChem CID | 139298265 |
| Molecular Formula | C30H35N5OS |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.26 |
| IUPAC Name | N-[3-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]prop-2-ynyl]cyclohexanamine |
| SMILES | Cc1cc(OCc2nnc(SC3C=CCCC3)n2-c2cccnc2)ccc1C#CCNC1CCCCC1 |
| InChI | InChI=1S/C30H35N5OS/c1-23-20-27(17-16-24(23)10-8-19-32-25-11-4-2-5-12-25)36-22-29-33-34-30(37-28-14-6-3-7-15-28)35(29)26-13-9-18-31-21-26/h6,9,13-14,16-18,20-21,25,28,32H,2-5,7,11-12,15,19,22H2,1H3 |
| InChIKey | ORUDNUNYPOIHKM-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|