C31H34N6O4S — CID 139298447
3-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]prop-2-ynyl 4-acetylpiperazine-1-carboxylate (PubChem CID 139298447) has the molecular formula C31H34N6O4S and a molecular weight of 586.72 g/mol. Its IUPAC name is 3-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]prop-2-ynyl 4-acetylpiperazine-1-carboxylate.
| Compound Name | 3-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]prop-2-ynyl 4-acetylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 139298447 |
| Molecular Formula | C31H34N6O4S |
| Molecular Weight | 586.72 g/mol |
| Exact Mass | 586.24 |
| IUPAC Name | 3-[4-[(5-cyclohex-2-en-1-ylsulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl)methoxy]-2-methylphenyl]prop-2-ynyl 4-acetylpiperazine-1-carboxylate |
| SMILES | CC(=O)N1CCN(C(=O)OCC#Cc2ccc(OCc3nnc(SC4C=CCCC4)n3-c3cccnc3)cc2C)CC1 |
| InChI | InChI=1S/C31H34N6O4S/c1-23-20-27(13-12-25(23)8-7-19-40-31(39)36-17-15-35(16-18-36)24(2)38)41-22-29-33-34-30(42-28-10-4-3-5-11-28)37(29)26-9-6-14-32-21-26/h4,6,9-10,12-14,20-21,28H,3,5,11,15-19,22H2,1-2H3 |
| InChIKey | KQCWTARDQAUMIE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 102.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|