C29H31N3O6 — CID 154981295
3-[4-[[2-(cyclohex-2-en-1-ylmethyl)-3-pyridin-3-ylimidazol-4-yl]methoxy]-2-hydroxyphenyl]prop-2-ynyl 4-hydroperoxybutanoate (PubChem CID 154981295) has the molecular formula C29H31N3O6 and a molecular weight of 517.58 g/mol. Its IUPAC name is 3-[4-[[2-(cyclohex-2-en-1-ylmethyl)-3-pyridin-3-ylimidazol-4-yl]methoxy]-2-hydroxyphenyl]prop-2-ynyl 4-hydroperoxybutanoate.
| Compound Name | 3-[4-[[2-(cyclohex-2-en-1-ylmethyl)-3-pyridin-3-ylimidazol-4-yl]methoxy]-2-hydroxyphenyl]prop-2-ynyl 4-hydroperoxybutanoate |
|---|---|
| PubChem CID | 154981295 |
| Molecular Formula | C29H31N3O6 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.22 |
| IUPAC Name | 3-[4-[[2-(cyclohex-2-en-1-ylmethyl)-3-pyridin-3-ylimidazol-4-yl]methoxy]-2-hydroxyphenyl]prop-2-ynyl 4-hydroperoxybutanoate |
| SMILES | O=C(CCCOO)OCC#Cc1ccc(OCc2cnc(CC3C=CCCC3)n2-c2cccnc2)cc1O |
| InChI | InChI=1S/C29H31N3O6/c33-27-18-26(13-12-23(27)9-5-15-36-29(34)11-6-16-38-35)37-21-25-20-31-28(17-22-7-2-1-3-8-22)32(25)24-10-4-14-30-19-24/h2,4,7,10,12-14,18-20,22,33,35H,1,3,6,8,11,15-17,21H2 |
| InChIKey | ADPAGSWXUGCVQG-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 115.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|