C28H30FN3O3S — CID 170243123
3-[2-cyclopentylsulfanyl-5-[[3-fluoro-4-[3-(oxan-2-yloxy)prop-1-ynyl]phenoxy]methyl]imidazol-1-yl]pyridine (PubChem CID 170243123) has the molecular formula C28H30FN3O3S and a molecular weight of 507.63 g/mol. Its IUPAC name is 3-[2-cyclopentylsulfanyl-5-[[3-fluoro-4-[3-(oxan-2-yloxy)prop-1-ynyl]phenoxy]methyl]imidazol-1-yl]pyridine.
| Compound Name | 3-[2-cyclopentylsulfanyl-5-[[3-fluoro-4-[3-(oxan-2-yloxy)prop-1-ynyl]phenoxy]methyl]imidazol-1-yl]pyridine |
|---|---|
| PubChem CID | 170243123 |
| Molecular Formula | C28H30FN3O3S |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 3-[2-cyclopentylsulfanyl-5-[[3-fluoro-4-[3-(oxan-2-yloxy)prop-1-ynyl]phenoxy]methyl]imidazol-1-yl]pyridine |
| SMILES | Fc1cc(OCc2cnc(SC3CCCC3)n2-c2cccnc2)ccc1C#CCOC1CCCCO1 |
| InChI | InChI=1S/C28H30FN3O3S/c29-26-17-24(13-12-21(26)7-6-16-34-27-11-3-4-15-33-27)35-20-23-19-31-28(36-25-9-1-2-10-25)32(23)22-8-5-14-30-18-22/h5,8,12-14,17-19,25,27H,1-4,9-11,15-16,20H2 |
| InChIKey | KKFYUUQOBAMZMW-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 58.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|