C32H35N3O5 — CID 154981294
3-[4-[[2-(cyclohex-2-en-1-ylmethyl)-3-pyridin-3-ylimidazol-4-yl]methoxy]-2-hydroxyphenyl]prop-2-ynyl 2-(oxan-4-yl)acetate (PubChem CID 154981294) has the molecular formula C32H35N3O5 and a molecular weight of 541.65 g/mol. Its IUPAC name is 3-[4-[[2-(cyclohex-2-en-1-ylmethyl)-3-pyridin-3-ylimidazol-4-yl]methoxy]-2-hydroxyphenyl]prop-2-ynyl 2-(oxan-4-yl)acetate.
| Compound Name | 3-[4-[[2-(cyclohex-2-en-1-ylmethyl)-3-pyridin-3-ylimidazol-4-yl]methoxy]-2-hydroxyphenyl]prop-2-ynyl 2-(oxan-4-yl)acetate |
|---|---|
| PubChem CID | 154981294 |
| Molecular Formula | C32H35N3O5 |
| Molecular Weight | 541.65 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | 3-[4-[[2-(cyclohex-2-en-1-ylmethyl)-3-pyridin-3-ylimidazol-4-yl]methoxy]-2-hydroxyphenyl]prop-2-ynyl 2-(oxan-4-yl)acetate |
| SMILES | O=C(CC1CCOCC1)OCC#Cc1ccc(OCc2cnc(CC3C=CCCC3)n2-c2cccnc2)cc1O |
| InChI | InChI=1S/C32H35N3O5/c36-30-20-29(11-10-26(30)8-5-15-39-32(37)19-25-12-16-38-17-13-25)40-23-28-22-34-31(18-24-6-2-1-3-7-24)35(28)27-9-4-14-33-21-27/h2,4,6,9-11,14,20-22,24-25,36H,1,3,7,12-13,15-19,23H2 |
| InChIKey | OCJJXZGDBABSJX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 95.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.65 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|