C29H36N6OS10 — CID 139298927
5-[[5-[[3-methyl-4-[3-[(1-methylpiperidin-4-yl)amino]prop-1-ynyl]phenoxy]methyl]-4-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]cyclopentane-1,1,2,2,3,3,4,4,5-nonathiol (PubChem CID 139298927) has the molecular formula C29H36N6OS10 and a molecular weight of 805.32 g/mol. Its IUPAC name is 5-[[5-[[3-methyl-4-[3-[(1-methylpiperidin-4-yl)amino]prop-1-ynyl]phenoxy]methyl]-4-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]cyclopentane-1,1,2,2,3,3,4,4,5-nonathiol.
| Compound Name | 5-[[5-[[3-methyl-4-[3-[(1-methylpiperidin-4-yl)amino]prop-1-ynyl]phenoxy]methyl]-4-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]cyclopentane-1,1,2,2,3,3,4,4,5-nonathiol |
|---|---|
| PubChem CID | 139298927 |
| Molecular Formula | C29H36N6OS10 |
| Molecular Weight | 805.32 g/mol |
| Exact Mass | 804.02 |
| IUPAC Name | 5-[[5-[[3-methyl-4-[3-[(1-methylpiperidin-4-yl)amino]prop-1-ynyl]phenoxy]methyl]-4-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]cyclopentane-1,1,2,2,3,3,4,4,5-nonathiol |
| SMILES | Cc1cc(OCc2nnc(SC3(S)C(S)(S)C(S)(S)C(S)(S)C3(S)S)n2-c2cccnc2)ccc1C#CCNC1CCN(C)CC1 |
| InChI | InChI=1S/C29H36N6OS10/c1-18-15-22(8-7-19(18)5-3-12-31-20-9-13-34(2)14-10-20)36-17-23-32-33-24(35(23)21-6-4-11-30-16-21)46-29(45)27(41,42)25(37,38)26(39,40)28(29,43)44/h4,6-8,11,15-16,20,31,37-45H,9-10,12-14,17H2,1-2H3 |
| InChIKey | ZZONYHPMYPYZAY-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 68.10 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.32 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|