C28H29N3O3S11 — CID 166925144
5-[5-[[3-methyl-4-(4-methylsulfonylphenyl)phenoxy]methyl]-1-pyridin-3-ylimidazol-2-yl]sulfanylcyclopentane-1,1,2,2,3,3,4,4,5-nonathiol (PubChem CID 166925144) has the molecular formula C28H29N3O3S11 and a molecular weight of 808.29 g/mol. Its IUPAC name is 5-[5-[[3-methyl-4-(4-methylsulfonylphenyl)phenoxy]methyl]-1-pyridin-3-ylimidazol-2-yl]sulfanylcyclopentane-1,1,2,2,3,3,4,4,5-nonathiol.
| Compound Name | 5-[5-[[3-methyl-4-(4-methylsulfonylphenyl)phenoxy]methyl]-1-pyridin-3-ylimidazol-2-yl]sulfanylcyclopentane-1,1,2,2,3,3,4,4,5-nonathiol |
|---|---|
| PubChem CID | 166925144 |
| Molecular Formula | C28H29N3O3S11 |
| Molecular Weight | 808.29 g/mol |
| Exact Mass | 806.91 |
| IUPAC Name | 5-[5-[[3-methyl-4-(4-methylsulfonylphenyl)phenoxy]methyl]-1-pyridin-3-ylimidazol-2-yl]sulfanylcyclopentane-1,1,2,2,3,3,4,4,5-nonathiol |
| SMILES | Cc1cc(OCc2cnc(SC3(S)C(S)(S)C(S)(S)C(S)(S)C3(S)S)n2-c2cccnc2)ccc1-c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C28H29N3O3S11/c1-16-12-20(7-10-22(16)17-5-8-21(9-6-17)45(2,32)33)34-15-19-14-30-23(31(19)18-4-3-11-29-13-18)44-28(43)26(39,40)24(35,36)25(37,38)27(28,41)42/h3-14,35-43H,15H2,1-2H3 |
| InChIKey | GYEKTLUJQROVAB-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 74.08 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.29 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|