C23H24N4O2S10 — CID 139298436
3-[2-methyl-4-[[5-[1,2,2,3,3,4,4,5,5-nonakis(sulfanyl)cyclopentyl]sulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl]methoxy]phenyl]prop-2-yn-1-ol (PubChem CID 139298436) has the molecular formula C23H24N4O2S10 and a molecular weight of 709.14 g/mol. Its IUPAC name is 3-[2-methyl-4-[[5-[1,2,2,3,3,4,4,5,5-nonakis(sulfanyl)cyclopentyl]sulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl]methoxy]phenyl]prop-2-yn-1-ol.
| Compound Name | 3-[2-methyl-4-[[5-[1,2,2,3,3,4,4,5,5-nonakis(sulfanyl)cyclopentyl]sulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl]methoxy]phenyl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 139298436 |
| Molecular Formula | C23H24N4O2S10 |
| Molecular Weight | 709.14 g/mol |
| Exact Mass | 707.91 |
| IUPAC Name | 3-[2-methyl-4-[[5-[1,2,2,3,3,4,4,5,5-nonakis(sulfanyl)cyclopentyl]sulfanyl-4-pyridin-3-yl-1,2,4-triazol-3-yl]methoxy]phenyl]prop-2-yn-1-ol |
| SMILES | Cc1cc(OCc2nnc(SC3(S)C(S)(S)C(S)(S)C(S)(S)C3(S)S)n2-c2cccnc2)ccc1C#CCO |
| InChI | InChI=1S/C23H24N4O2S10/c1-13-10-16(7-6-14(13)4-3-9-28)29-12-17-25-26-18(27(17)15-5-2-8-24-11-15)39-23(38)21(34,35)19(30,31)20(32,33)22(23,36)37/h2,5-8,10-11,28,30-38H,9,12H2,1H3 |
| InChIKey | LFSDSYNQQKYUDC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.14 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|