C7H13N3O2S — CID 139308987
(2R)-2-[[(2R)-2-aminopropanoyl]amino]-3-sulfanylbut-3-enamide (PubChem CID 139308987) has the molecular formula C7H13N3O2S and a molecular weight of 203.27 g/mol. Its IUPAC name is (2R)-2-[[(2R)-2-aminopropanoyl]amino]-3-sulfanylbut-3-enamide.
| Compound Name | (2R)-2-[[(2R)-2-aminopropanoyl]amino]-3-sulfanylbut-3-enamide |
|---|---|
| PubChem CID | 139308987 |
| Molecular Formula | C7H13N3O2S |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | (2R)-2-[[(2R)-2-aminopropanoyl]amino]-3-sulfanylbut-3-enamide |
| SMILES | C=C(S)[C@H](NC(=O)[C@@H](C)N)C(N)=O |
| InChI | InChI=1S/C7H13N3O2S/c1-3(8)7(12)10-5(4(2)13)6(9)11/h3,5,13H,2,8H2,1H3,(H2,9,11)(H,10,12)/t3-,5+/m1/s1 |
| InChIKey | RDZONDTYKAKEEL-WUJLRWPWSA-N |
| XLogP | -1.25 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|