C20H21N3O4S3 — CID 139311208
3-[(5S)-8-[(1R)-1-(1,3-benzodioxol-5-yl)propyl]-5,6-dimethyl-7,9-dioxo-3-sulfanylidene-2,4-dithia-6,8-diazabicyclo[3.2.2]nonan-1-yl]propanenitrile (PubChem CID 139311208) has the molecular formula C20H21N3O4S3 and a molecular weight of 463.61 g/mol. Its IUPAC name is 3-[(5S)-8-[(1R)-1-(1,3-benzodioxol-5-yl)propyl]-5,6-dimethyl-7,9-dioxo-3-sulfanylidene-2,4-dithia-6,8-diazabicyclo[3.2.2]nonan-1-yl]propanenitrile.
| Compound Name | 3-[(5S)-8-[(1R)-1-(1,3-benzodioxol-5-yl)propyl]-5,6-dimethyl-7,9-dioxo-3-sulfanylidene-2,4-dithia-6,8-diazabicyclo[3.2.2]nonan-1-yl]propanenitrile |
|---|---|
| PubChem CID | 139311208 |
| Molecular Formula | C20H21N3O4S3 |
| Molecular Weight | 463.61 g/mol |
| Exact Mass | 463.07 |
| IUPAC Name | 3-[(5S)-8-[(1R)-1-(1,3-benzodioxol-5-yl)propyl]-5,6-dimethyl-7,9-dioxo-3-sulfanylidene-2,4-dithia-6,8-diazabicyclo[3.2.2]nonan-1-yl]propanenitrile |
| SMILES | CC[C@H](c1ccc2c(c1)OCO2)N1C(=O)[C@]2(C)SC(=S)SC1(CCC#N)C(=O)N2C |
| InChI | InChI=1S/C20H21N3O4S3/c1-4-13(12-6-7-14-15(10-12)27-11-26-14)23-16(24)19(2)22(3)17(25)20(23,8-5-9-21)30-18(28)29-19/h6-7,10,13H,4-5,8,11H2,1-3H3/t13-,19+,20?/m1/s1 |
| InChIKey | UACLEXGYGMUBCV-LZXZIGIKSA-N |
| XLogP | 3.65 |
| TPSA | 82.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.61 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|