C20H23N3O5S2 — CID 134578652
3-[7-[1-(1,3-benzodioxol-5-yl)-3-methoxypropyl]-4,5-dimethyl-6,8-dioxo-2,3-dithia-5,7-diazabicyclo[2.2.2]octan-1-yl]propanenitrile (PubChem CID 134578652) has the molecular formula C20H23N3O5S2 and a molecular weight of 449.55 g/mol. Its IUPAC name is 3-[7-[1-(1,3-benzodioxol-5-yl)-3-methoxypropyl]-4,5-dimethyl-6,8-dioxo-2,3-dithia-5,7-diazabicyclo[2.2.2]octan-1-yl]propanenitrile.
| Compound Name | 3-[7-[1-(1,3-benzodioxol-5-yl)-3-methoxypropyl]-4,5-dimethyl-6,8-dioxo-2,3-dithia-5,7-diazabicyclo[2.2.2]octan-1-yl]propanenitrile |
|---|---|
| PubChem CID | 134578652 |
| Molecular Formula | C20H23N3O5S2 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.11 |
| IUPAC Name | 3-[7-[1-(1,3-benzodioxol-5-yl)-3-methoxypropyl]-4,5-dimethyl-6,8-dioxo-2,3-dithia-5,7-diazabicyclo[2.2.2]octan-1-yl]propanenitrile |
| SMILES | COCCC(c1ccc2c(c1)OCO2)N1C(=O)C2(C)SSC1(CCC#N)C(=O)N2C |
| InChI | InChI=1S/C20H23N3O5S2/c1-19-17(24)23(20(30-29-19,8-4-9-21)18(25)22(19)2)14(7-10-26-3)13-5-6-15-16(11-13)28-12-27-15/h5-6,11,14H,4,7-8,10,12H2,1-3H3 |
| InChIKey | MFRBRKXIWQXCCS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 92.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|