C14H12N2O3 — CID 15520856
2-[1,3-benzodioxol-5-yl(2-cyanoethoxy)methyl]prop-2-enenitrile (PubChem CID 15520856) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-yl(2-cyanoethoxy)methyl]prop-2-enenitrile.
| Compound Name | 2-[1,3-benzodioxol-5-yl(2-cyanoethoxy)methyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 15520856 |
| Molecular Formula | C14H12N2O3 |
| Molecular Weight | 256.26 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-[1,3-benzodioxol-5-yl(2-cyanoethoxy)methyl]prop-2-enenitrile |
| SMILES | C=C(C#N)C(OCCC#N)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H12N2O3/c1-10(8-16)14(17-6-2-5-15)11-3-4-12-13(7-11)19-9-18-12/h3-4,7,14H,1-2,6,9H2 |
| InChIKey | SRYWMBABWVZHCG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|