C13H12O2 — CID 57062627
5-(3-methylidenepent-4-yn-2-yl)-1,3-benzodioxole (PubChem CID 57062627) has the molecular formula C13H12O2 and a molecular weight of 200.24 g/mol. Its IUPAC name is 5-(3-methylidenepent-4-yn-2-yl)-1,3-benzodioxole.
| Compound Name | 5-(3-methylidenepent-4-yn-2-yl)-1,3-benzodioxole |
|---|---|
| PubChem CID | 57062627 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 5-(3-methylidenepent-4-yn-2-yl)-1,3-benzodioxole |
| SMILES | C#CC(=C)C(C)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H12O2/c1-4-9(2)10(3)11-5-6-12-13(7-11)15-8-14-12/h1,5-7,10H,2,8H2,3H3 |
| InChIKey | YOJSUTGNTMVEJO-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|