C31H30O4 — CID 139311427
(1E,6E)-1-(3H-inden-5-yl)-7-[2-methoxy-5-[(3Z,5Z)-2-methylidenehepta-3,5-dienoxy]phenyl]hepta-1,6-diene-3,5-dione (PubChem CID 139311427) has the molecular formula C31H30O4 and a molecular weight of 466.58 g/mol. Its IUPAC name is (1E,6E)-1-(3H-inden-5-yl)-7-[2-methoxy-5-[(3Z,5Z)-2-methylidenehepta-3,5-dienoxy]phenyl]hepta-1,6-diene-3,5-dione.
| Compound Name | (1E,6E)-1-(3H-inden-5-yl)-7-[2-methoxy-5-[(3Z,5Z)-2-methylidenehepta-3,5-dienoxy]phenyl]hepta-1,6-diene-3,5-dione |
|---|---|
| PubChem CID | 139311427 |
| Molecular Formula | C31H30O4 |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.21 |
| IUPAC Name | (1E,6E)-1-(3H-inden-5-yl)-7-[2-methoxy-5-[(3Z,5Z)-2-methylidenehepta-3,5-dienoxy]phenyl]hepta-1,6-diene-3,5-dione |
| SMILES | C=C(/C=C\C=C/C)COc1ccc(OC)c(/C=C/C(=O)CC(=O)/C=C/c2ccc3c(c2)CC=C3)c1 |
| InChI | InChI=1S/C31H30O4/c1-4-5-6-8-23(2)22-35-30-17-18-31(34-3)27(20-30)14-16-29(33)21-28(32)15-12-24-11-13-25-9-7-10-26(25)19-24/h4-9,11-20H,2,10,21-22H2,1,3H3/b5-4-,8-6-,15-12+,16-14+ |
| InChIKey | RHHQRNICHGGEKN-VPKQWLFZSA-N |
| XLogP | 6.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|