C12H19N5O — CID 139313951
3,4-dimethyl-N'-pyrazin-2-ylpiperidine-1-carbohydrazide (PubChem CID 139313951) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 3,4-dimethyl-N'-pyrazin-2-ylpiperidine-1-carbohydrazide.
| Compound Name | 3,4-dimethyl-N'-pyrazin-2-ylpiperidine-1-carbohydrazide |
|---|---|
| PubChem CID | 139313951 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 3,4-dimethyl-N'-pyrazin-2-ylpiperidine-1-carbohydrazide |
| SMILES | CC1CCN(C(=O)NNc2cnccn2)CC1C |
| InChI | InChI=1S/C12H19N5O/c1-9-3-6-17(8-10(9)2)12(18)16-15-11-7-13-4-5-14-11/h4-5,7,9-10H,3,6,8H2,1-2H3,(H,14,15)(H,16,18) |
| InChIKey | HSNSJCAXMIWRDV-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|