C28H31NO7S2 — CID 139316276
[6-(4-methoxybutylsulfanyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] (2,2-dimethyl-5-oxo-6-tricyclo[4.2.0.01,3]octanyl)methanesulfonate (PubChem CID 139316276) has the molecular formula C28H31NO7S2 and a molecular weight of 557.69 g/mol. Its IUPAC name is [6-(4-methoxybutylsulfanyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] (2,2-dimethyl-5-oxo-6-tricyclo[4.2.0.01,3]octanyl)methanesulfonate.
| Compound Name | [6-(4-methoxybutylsulfanyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] (2,2-dimethyl-5-oxo-6-tricyclo[4.2.0.01,3]octanyl)methanesulfonate |
|---|---|
| PubChem CID | 139316276 |
| Molecular Formula | C28H31NO7S2 |
| Molecular Weight | 557.69 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | [6-(4-methoxybutylsulfanyl)-1,3-dioxobenzo[de]isoquinolin-2-yl] (2,2-dimethyl-5-oxo-6-tricyclo[4.2.0.01,3]octanyl)methanesulfonate |
| SMILES | COCCCCSc1ccc2c3c(cccc13)C(=O)N(OS(=O)(=O)CC13CCC14C(CC3=O)C4(C)C)C2=O |
| InChI | InChI=1S/C28H31NO7S2/c1-26(2)21-15-22(30)27(11-12-28(21,26)27)16-38(33,34)36-29-24(31)18-8-6-7-17-20(37-14-5-4-13-35-3)10-9-19(23(17)18)25(29)32/h6-10,21H,4-5,11-16H2,1-3H3 |
| InChIKey | AKQKINBBCQKABH-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 107.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.69 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|