C13H24NO+ — CID 1393166
(2S,4S,5S)-2,5-dimethyl-1,1-bis(prop-2-enyl)piperidin-1-ium-4-ol (PubChem CID 1393166) has the molecular formula C13H24NO+ and a molecular weight of 210.34 g/mol. Its IUPAC name is (2S,4S,5S)-2,5-dimethyl-1,1-bis(prop-2-enyl)piperidin-1-ium-4-ol.
| Compound Name | (2S,4S,5S)-2,5-dimethyl-1,1-bis(prop-2-enyl)piperidin-1-ium-4-ol |
|---|---|
| PubChem CID | 1393166 |
| Molecular Formula | C13H24NO+ |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.19 |
| IUPAC Name | (2S,4S,5S)-2,5-dimethyl-1,1-bis(prop-2-enyl)piperidin-1-ium-4-ol |
| SMILES | C=CC[N+]1(CC=C)C[C@H](C)[C@@H](O)C[C@@H]1C |
| InChI | InChI=1S/C13H24NO/c1-5-7-14(8-6-2)10-11(3)13(15)9-12(14)4/h5-6,11-13,15H,1-2,7-10H2,3-4H3/q+1/t11-,12-,13-/m0/s1 |
| InChIKey | HXYOEAIXJQKOJY-AVGNSLFASA-N |
| XLogP | 1.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|