C12H12O5S2 — CID 139325466
2-[(2-oxochromen-4-yl)methylsulfanyl]ethanesulfonic acid (PubChem CID 139325466) has the molecular formula C12H12O5S2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 2-[(2-oxochromen-4-yl)methylsulfanyl]ethanesulfonic acid.
| Compound Name | 2-[(2-oxochromen-4-yl)methylsulfanyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 139325466 |
| Molecular Formula | C12H12O5S2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 2-[(2-oxochromen-4-yl)methylsulfanyl]ethanesulfonic acid |
| SMILES | O=c1cc(CSCCS(=O)(=O)O)c2ccccc2o1 |
| InChI | InChI=1S/C12H12O5S2/c13-12-7-9(8-18-5-6-19(14,15)16)10-3-1-2-4-11(10)17-12/h1-4,7H,5-6,8H2,(H,14,15,16) |
| InChIKey | FUCGSUQGJOKEGI-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|