C11H23F2NO2S — CID 139325517
N-(1,1-difluoroethyl)-2,2,3,3-tetramethylpentane-1-sulfonamide (PubChem CID 139325517) has the molecular formula C11H23F2NO2S and a molecular weight of 271.37 g/mol. Its IUPAC name is N-(1,1-difluoroethyl)-2,2,3,3-tetramethylpentane-1-sulfonamide.
| Compound Name | N-(1,1-difluoroethyl)-2,2,3,3-tetramethylpentane-1-sulfonamide |
|---|---|
| PubChem CID | 139325517 |
| Molecular Formula | C11H23F2NO2S |
| Molecular Weight | 271.37 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | N-(1,1-difluoroethyl)-2,2,3,3-tetramethylpentane-1-sulfonamide |
| SMILES | CCC(C)(C)C(C)(C)CS(=O)(=O)NC(C)(F)F |
| InChI | InChI=1S/C11H23F2NO2S/c1-7-9(2,3)10(4,5)8-17(15,16)14-11(6,12)13/h14H,7-8H2,1-6H3 |
| InChIKey | QQFKYBFXSVEMDX-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|