C20H26O — CID 139329775
4-[5-(4-ethylphenyl)pentyl]cyclohepta-2,6-dien-1-one (PubChem CID 139329775) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is 4-[5-(4-ethylphenyl)pentyl]cyclohepta-2,6-dien-1-one.
| Compound Name | 4-[5-(4-ethylphenyl)pentyl]cyclohepta-2,6-dien-1-one |
|---|---|
| PubChem CID | 139329775 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 4-[5-(4-ethylphenyl)pentyl]cyclohepta-2,6-dien-1-one |
| SMILES | CCc1ccc(CCCCCC2C=CC(=O)C=CC2)cc1 |
| InChI | InChI=1S/C20H26O/c1-2-17-11-13-19(14-12-17)8-5-3-4-7-18-9-6-10-20(21)16-15-18/h6,10-16,18H,2-5,7-9H2,1H3 |
| InChIKey | PCSXYZQPQAGKIP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|