C8H8F2N4S — CID 139358422
2-(difluoromethyl)-N'-methylimidazo[2,1-b][1,3]thiazole-5-carboximidamide (PubChem CID 139358422) has the molecular formula C8H8F2N4S and a molecular weight of 230.24 g/mol. Its IUPAC name is 2-(difluoromethyl)-N'-methylimidazo[2,1-b][1,3]thiazole-5-carboximidamide.
| Compound Name | 2-(difluoromethyl)-N'-methylimidazo[2,1-b][1,3]thiazole-5-carboximidamide |
|---|---|
| PubChem CID | 139358422 |
| Molecular Formula | C8H8F2N4S |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | 2-(difluoromethyl)-N'-methylimidazo[2,1-b][1,3]thiazole-5-carboximidamide |
| SMILES | C/N=C(\N)c1cnc2sc(C(F)F)cn12 |
| InChI | InChI=1S/C8H8F2N4S/c1-12-7(11)4-2-13-8-14(4)3-5(15-8)6(9)10/h2-3,6H,1H3,(H2,11,12) |
| InChIKey | VGZQTBGFHGTGKV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 55.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|