C14H11ClN2O5 — CID 139360033
N-[(E)-(2-chloro-4-hydroxyphenyl)methylideneamino]-3,4,5-trihydroxybenzamide (PubChem CID 139360033) has the molecular formula C14H11ClN2O5 and a molecular weight of 322.70 g/mol. Its IUPAC name is N-[(E)-(2-chloro-4-hydroxyphenyl)methylideneamino]-3,4,5-trihydroxybenzamide.
| Compound Name | N-[(E)-(2-chloro-4-hydroxyphenyl)methylideneamino]-3,4,5-trihydroxybenzamide |
|---|---|
| PubChem CID | 139360033 |
| Molecular Formula | C14H11ClN2O5 |
| Molecular Weight | 322.70 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | N-[(E)-(2-chloro-4-hydroxyphenyl)methylideneamino]-3,4,5-trihydroxybenzamide |
| SMILES | O=C(N/N=C/c1ccc(O)cc1Cl)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C14H11ClN2O5/c15-10-5-9(18)2-1-7(10)6-16-17-14(22)8-3-11(19)13(21)12(20)4-8/h1-6,18-21H,(H,17,22)/b16-6+ |
| InChIKey | JYCOVNZIEBGZQI-OMCISZLKSA-N |
| XLogP | 1.93 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.70 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|