C41H48N4O6 — CID 139366606
tert-butyl (2E,5S,6R,7E)-8-[4-(azidomethyl)phenyl]-5-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxy-6-methylocta-2,7-dienoate (PubChem CID 139366606) has the molecular formula C41H48N4O6 and a molecular weight of 692.86 g/mol. Its IUPAC name is tert-butyl (2E,5S,6R,7E)-8-[4-(azidomethyl)phenyl]-5-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxy-6-methylocta-2,7-dienoate.
| Compound Name | tert-butyl (2E,5S,6R,7E)-8-[4-(azidomethyl)phenyl]-5-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxy-6-methylocta-2,7-dienoate |
|---|---|
| PubChem CID | 139366606 |
| Molecular Formula | C41H48N4O6 |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 692.36 |
| IUPAC Name | tert-butyl (2E,5S,6R,7E)-8-[4-(azidomethyl)phenyl]-5-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxy-6-methylocta-2,7-dienoate |
| SMILES | CC(C)C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O[C@@H](C/C=C/C(=O)OC(C)(C)C)[C@H](C)/C=C/c1ccc(CN=[N+]=[N-])cc1 |
| InChI | InChI=1S/C41H48N4O6/c1-27(2)24-36(44-40(48)49-26-35-33-14-9-7-12-31(33)32-13-8-10-15-34(32)35)39(47)50-37(16-11-17-38(46)51-41(4,5)6)28(3)18-19-29-20-22-30(23-21-29)25-43-45-42/h7-15,17-23,27-28,35-37H,16,24-26H2,1-6H3,(H,44,48)/b17-11+,19-18+/t28-,36+,37+/m1/s1 |
| InChIKey | BCIHWRYYZMCHNO-HCRNMVQWSA-N |
| XLogP | 9.30 |
| TPSA | 139.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|