C27H18N4O5 — CID 139368955
methyl 3-[[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]methyl]benzoate (PubChem CID 139368955) has the molecular formula C27H18N4O5 and a molecular weight of 478.46 g/mol. Its IUPAC name is methyl 3-[[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]methyl]benzoate.
| Compound Name | methyl 3-[[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 139368955 |
| Molecular Formula | C27H18N4O5 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | methyl 3-[[4-(8-cyano-2,4-dioxopyrimido[4,5-b]quinolin-10-yl)phenoxy]methyl]benzoate |
| SMILES | COC(=O)c1cccc(COc2ccc(-n3c4nc(=O)[nH]c(=O)c-4cc4ccc(C#N)cc43)cc2)c1 |
| InChI | InChI=1S/C27H18N4O5/c1-35-26(33)19-4-2-3-17(11-19)15-36-21-9-7-20(8-10-21)31-23-12-16(14-28)5-6-18(23)13-22-24(31)29-27(34)30-25(22)32/h2-13H,15H2,1H3,(H,30,32,34) |
| InChIKey | CZTLJXFEFYRTHE-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 127.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|