C19H12N4O3 — CID 71819005
10-(4-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile (PubChem CID 71819005) has the molecular formula C19H12N4O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is 10-(4-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile.
| Compound Name | 10-(4-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile |
|---|---|
| PubChem CID | 71819005 |
| Molecular Formula | C19H12N4O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | 10-(4-methoxyphenyl)-2,4-dioxopyrimido[4,5-b]quinoline-8-carbonitrile |
| SMILES | COc1ccc(-n2c3nc(=O)[nH]c(=O)c-3cc3ccc(C#N)cc32)cc1 |
| InChI | InChI=1S/C19H12N4O3/c1-26-14-6-4-13(5-7-14)23-16-8-11(10-20)2-3-12(16)9-15-17(23)21-19(25)22-18(15)24/h2-9H,1H3,(H,22,24,25) |
| InChIKey | SYMYDNJITZGATF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 100.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|