C27H28FN7O3S — CID 139369327
[(4aR,8aR)-1-(4-fluorophenyl)-6-(2-propyltriazol-4-yl)sulfonyl-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone (PubChem CID 139369327) has the molecular formula C27H28FN7O3S and a molecular weight of 549.63 g/mol. Its IUPAC name is [(4aR,8aR)-1-(4-fluorophenyl)-6-(2-propyltriazol-4-yl)sulfonyl-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone.
| Compound Name | [(4aR,8aR)-1-(4-fluorophenyl)-6-(2-propyltriazol-4-yl)sulfonyl-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone |
|---|---|
| PubChem CID | 139369327 |
| Molecular Formula | C27H28FN7O3S |
| Molecular Weight | 549.63 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | [(4aR,8aR)-1-(4-fluorophenyl)-6-(2-propyltriazol-4-yl)sulfonyl-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinolin-4a-yl]-pyridin-2-ylmethanone |
| SMILES | CCCn1ncc(S(=O)(=O)N2CC[C@@H]3Cc4c(cnn4-c4ccc(F)cc4)C[C@]3(C(=O)c3ccccn3)C2)n1 |
| InChI | InChI=1S/C27H28FN7O3S/c1-2-12-34-30-17-25(32-34)39(37,38)33-13-10-20-14-24-19(16-31-35(24)22-8-6-21(28)7-9-22)15-27(20,18-33)26(36)23-5-3-4-11-29-23/h3-9,11,16-17,20H,2,10,12-15,18H2,1H3/t20-,27+/m1/s1 |
| InChIKey | CABSVADZAWZSLR-HRFSGMKKSA-N |
| XLogP | 3.09 |
| TPSA | 115.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.63 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |