C25H26FN7O3S2 — CID 123630765
[1-(4-fluorophenyl)-6-(2-propyltriazol-4-yl)sulfonyl-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-4-yl)methanone (PubChem CID 123630765) has the molecular formula C25H26FN7O3S2 and a molecular weight of 555.66 g/mol. Its IUPAC name is [1-(4-fluorophenyl)-6-(2-propyltriazol-4-yl)sulfonyl-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-4-yl)methanone.
| Compound Name | [1-(4-fluorophenyl)-6-(2-propyltriazol-4-yl)sulfonyl-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-4-yl)methanone |
|---|---|
| PubChem CID | 123630765 |
| Molecular Formula | C25H26FN7O3S2 |
| Molecular Weight | 555.66 g/mol |
| Exact Mass | 555.15 |
| IUPAC Name | [1-(4-fluorophenyl)-6-(2-propyltriazol-4-yl)sulfonyl-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinolin-4a-yl]-(1,3-thiazol-4-yl)methanone |
| SMILES | CCCn1ncc(S(=O)(=O)N2CCC3Cc4c(cnn4-c4ccc(F)cc4)CC3(C(=O)c3cscn3)C2)n1 |
| InChI | InChI=1S/C25H26FN7O3S2/c1-2-8-32-28-13-23(30-32)38(35,36)31-9-7-18-10-22-17(12-29-33(22)20-5-3-19(26)4-6-20)11-25(18,15-31)24(34)21-14-37-16-27-21/h3-6,12-14,16,18H,2,7-11,15H2,1H3 |
| InChIKey | HMRQYZWVZUZJFV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 115.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.66 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |