C24H22F3N3O4S — CID 118092363
methyl (4aR,8aS)-6-(3,4-difluorophenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-4a-carboxylate (PubChem CID 118092363) has the molecular formula C24H22F3N3O4S and a molecular weight of 505.52 g/mol. Its IUPAC name is methyl (4aR,8aS)-6-(3,4-difluorophenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-4a-carboxylate.
| Compound Name | methyl (4aR,8aS)-6-(3,4-difluorophenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 118092363 |
| Molecular Formula | C24H22F3N3O4S |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.13 |
| IUPAC Name | methyl (4aR,8aS)-6-(3,4-difluorophenyl)sulfonyl-1-(4-fluorophenyl)-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-4a-carboxylate |
| SMILES | COC(=O)[C@]12Cc3cnn(-c4ccc(F)cc4)c3C[C@@H]1CCN(S(=O)(=O)c1ccc(F)c(F)c1)C2 |
| InChI | InChI=1S/C24H22F3N3O4S/c1-34-23(31)24-12-15-13-28-30(18-4-2-17(25)3-5-18)22(15)10-16(24)8-9-29(14-24)35(32,33)19-6-7-20(26)21(27)11-19/h2-7,11,13,16H,8-10,12,14H2,1H3/t16-,24-/m0/s1 |
| InChIKey | AJLITVPDVJZSIG-FYSMJZIKSA-N |
| XLogP | 3.26 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |