C25H23F4N3O4S — CID 118092338
methyl 1-(4-fluorophenyl)-6-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-4a-carboxylate (PubChem CID 118092338) has the molecular formula C25H23F4N3O4S and a molecular weight of 537.54 g/mol. Its IUPAC name is methyl 1-(4-fluorophenyl)-6-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-4a-carboxylate.
| Compound Name | methyl 1-(4-fluorophenyl)-6-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-4a-carboxylate |
|---|---|
| PubChem CID | 118092338 |
| Molecular Formula | C25H23F4N3O4S |
| Molecular Weight | 537.54 g/mol |
| Exact Mass | 537.13 |
| IUPAC Name | methyl 1-(4-fluorophenyl)-6-[4-(trifluoromethyl)phenyl]sulfonyl-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-4a-carboxylate |
| SMILES | COC(=O)C12Cc3cnn(-c4ccc(F)cc4)c3CC1CCN(S(=O)(=O)c1ccc(C(F)(F)F)cc1)C2 |
| InChI | InChI=1S/C25H23F4N3O4S/c1-36-23(33)24-13-16-14-30-32(20-6-4-19(26)5-7-20)22(16)12-18(24)10-11-31(15-24)37(34,35)21-8-2-17(3-9-21)25(27,28)29/h2-9,14,18H,10-13,15H2,1H3 |
| InChIKey | QBIUKZURCQYBFH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.54 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |