C25H27FN4O3S — CID 118092370
tert-butyl (4aR)-1-(4-fluorophenyl)-4a-(1,3-thiazole-5-carbonyl)-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-6-carboxylate (PubChem CID 118092370) has the molecular formula C25H27FN4O3S and a molecular weight of 482.58 g/mol. Its IUPAC name is tert-butyl (4aR)-1-(4-fluorophenyl)-4a-(1,3-thiazole-5-carbonyl)-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-6-carboxylate.
| Compound Name | tert-butyl (4aR)-1-(4-fluorophenyl)-4a-(1,3-thiazole-5-carbonyl)-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-6-carboxylate |
|---|---|
| PubChem CID | 118092370 |
| Molecular Formula | C25H27FN4O3S |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | tert-butyl (4aR)-1-(4-fluorophenyl)-4a-(1,3-thiazole-5-carbonyl)-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2Cc3c(cnn3-c3ccc(F)cc3)C[C@]2(C(=O)c2cncs2)C1 |
| InChI | InChI=1S/C25H27FN4O3S/c1-24(2,3)33-23(32)29-9-8-17-10-20-16(12-28-30(20)19-6-4-18(26)5-7-19)11-25(17,14-29)22(31)21-13-27-15-34-21/h4-7,12-13,15,17H,8-11,14H2,1-3H3/t17?,25-/m0/s1 |
| InChIKey | QWTUDDVMBBGWMJ-HHPDBAQJSA-N |
| XLogP | 4.69 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |