C25H29FN4O3S — CID 155642339
tert-butyl (4aS,7Z,8aR)-7-(aminomethylidene)-6-(4-fluorophenyl)imino-8a-(1,3-thiazole-4-carbonyl)-1,3,4,4a,5,8-hexahydroisoquinoline-2-carboxylate (PubChem CID 155642339) has the molecular formula C25H29FN4O3S and a molecular weight of 484.60 g/mol. Its IUPAC name is tert-butyl (4aS,7Z,8aR)-7-(aminomethylidene)-6-(4-fluorophenyl)imino-8a-(1,3-thiazole-4-carbonyl)-1,3,4,4a,5,8-hexahydroisoquinoline-2-carboxylate.
| Compound Name | tert-butyl (4aS,7Z,8aR)-7-(aminomethylidene)-6-(4-fluorophenyl)imino-8a-(1,3-thiazole-4-carbonyl)-1,3,4,4a,5,8-hexahydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 155642339 |
| Molecular Formula | C25H29FN4O3S |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | tert-butyl (4aS,7Z,8aR)-7-(aminomethylidene)-6-(4-fluorophenyl)imino-8a-(1,3-thiazole-4-carbonyl)-1,3,4,4a,5,8-hexahydroisoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H]2CC(=N\c3ccc(F)cc3)/C(=C\N)C[C@]2(C(=O)c2cscn2)C1 |
| InChI | InChI=1S/C25H29FN4O3S/c1-24(2,3)33-23(32)30-9-8-17-10-20(29-19-6-4-18(26)5-7-19)16(12-27)11-25(17,14-30)22(31)21-13-34-15-28-21/h4-7,12-13,15,17H,8-11,14,27H2,1-3H3/b16-12-,29-20+/t17-,25-/m0/s1 |
| InChIKey | BCQFMBHNCVZLSO-RCBWVWBZSA-N |
| XLogP | 5.12 |
| TPSA | 97.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|