C23H28FN3O4 — CID 118097395
6-O-butyl 4a-O-methyl 1-(4-fluorophenyl)-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-4a,6-dicarboxylate (PubChem CID 118097395) has the molecular formula C23H28FN3O4 and a molecular weight of 429.49 g/mol. Its IUPAC name is 6-O-butyl 4a-O-methyl 1-(4-fluorophenyl)-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-4a,6-dicarboxylate.
| Compound Name | 6-O-butyl 4a-O-methyl 1-(4-fluorophenyl)-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-4a,6-dicarboxylate |
|---|---|
| PubChem CID | 118097395 |
| Molecular Formula | C23H28FN3O4 |
| Molecular Weight | 429.49 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 6-O-butyl 4a-O-methyl 1-(4-fluorophenyl)-4,5,7,8,8a,9-hexahydropyrazolo[5,4-g]isoquinoline-4a,6-dicarboxylate |
| SMILES | CCCCOC(=O)N1CCC2Cc3c(cnn3-c3ccc(F)cc3)CC2(C(=O)OC)C1 |
| InChI | InChI=1S/C23H28FN3O4/c1-3-4-11-31-22(29)26-10-9-17-12-20-16(13-23(17,15-26)21(28)30-2)14-25-27(20)19-7-5-18(24)6-8-19/h5-8,14,17H,3-4,9-13,15H2,1-2H3 |
| InChIKey | DVOUDXYXNFEEOL-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.49 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|