C26H29FN2O4 — CID 142877083
dimethyl 8-(4-fluorophenyl)-11a-methyl-3,4,4a,5,6,6a,7,11-octahydro-2H-naphtho[5,6-f]indazole-3,4-dicarboxylate (PubChem CID 142877083) has the molecular formula C26H29FN2O4 and a molecular weight of 452.53 g/mol. Its IUPAC name is dimethyl 8-(4-fluorophenyl)-11a-methyl-3,4,4a,5,6,6a,7,11-octahydro-2H-naphtho[5,6-f]indazole-3,4-dicarboxylate.
| Compound Name | dimethyl 8-(4-fluorophenyl)-11a-methyl-3,4,4a,5,6,6a,7,11-octahydro-2H-naphtho[5,6-f]indazole-3,4-dicarboxylate |
|---|---|
| PubChem CID | 142877083 |
| Molecular Formula | C26H29FN2O4 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | dimethyl 8-(4-fluorophenyl)-11a-methyl-3,4,4a,5,6,6a,7,11-octahydro-2H-naphtho[5,6-f]indazole-3,4-dicarboxylate |
| SMILES | COC(=O)C1CC=C2C(CCC3Cc4c(cnn4-c4ccc(F)cc4)CC23C)C1C(=O)OC |
| InChI | InChI=1S/C26H29FN2O4/c1-26-13-15-14-28-29(18-7-5-17(27)6-8-18)22(15)12-16(26)4-9-19-21(26)11-10-20(24(30)32-2)23(19)25(31)33-3/h5-8,11,14,16,19-20,23H,4,9-10,12-13H2,1-3H3 |
| InChIKey | QEUZCGQPWKNZGE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|