C31H29F4N3O — CID 10030080
(3R,4R,11aS)-8-(4-fluorophenyl)-11a-methyl-N-(3-methylphenyl)-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole-4-carboxamide (PubChem CID 10030080) has the molecular formula C31H29F4N3O and a molecular weight of 535.59 g/mol. Its IUPAC name is (3R,4R,11aS)-8-(4-fluorophenyl)-11a-methyl-N-(3-methylphenyl)-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole-4-carboxamide.
| Compound Name | (3R,4R,11aS)-8-(4-fluorophenyl)-11a-methyl-N-(3-methylphenyl)-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole-4-carboxamide |
|---|---|
| PubChem CID | 10030080 |
| Molecular Formula | C31H29F4N3O |
| Molecular Weight | 535.59 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | (3R,4R,11aS)-8-(4-fluorophenyl)-11a-methyl-N-(3-methylphenyl)-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole-4-carboxamide |
| SMILES | Cc1cccc(NC(=O)[C@@H]2C3CCC4=Cc5c(cnn5-c5ccc(F)cc5)C[C@]4(C)C3=CC[C@H]2C(F)(F)F)c1 |
| InChI | InChI=1S/C31H29F4N3O/c1-18-4-3-5-22(14-18)37-29(39)28-24-11-6-20-15-27-19(17-36-38(27)23-9-7-21(32)8-10-23)16-30(20,2)25(24)12-13-26(28)31(33,34)35/h3-5,7-10,12,14-15,17,24,26,28H,6,11,13,16H2,1-2H3,(H,37,39)/t24?,26-,28-,30+/m1/s1 |
| InChIKey | ORSHKJQHJKHMNG-FBJAOQLLSA-N |
| XLogP | 7.44 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.59 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|