C32H39FN2O2 — CID 20525191
1-[8-(4-fluorophenyl)-11a-methyl-4-(2-oxopentyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-3-yl]pentan-2-one (PubChem CID 20525191) has the molecular formula C32H39FN2O2 and a molecular weight of 502.67 g/mol. Its IUPAC name is 1-[8-(4-fluorophenyl)-11a-methyl-4-(2-oxopentyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-3-yl]pentan-2-one.
| Compound Name | 1-[8-(4-fluorophenyl)-11a-methyl-4-(2-oxopentyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-3-yl]pentan-2-one |
|---|---|
| PubChem CID | 20525191 |
| Molecular Formula | C32H39FN2O2 |
| Molecular Weight | 502.67 g/mol |
| Exact Mass | 502.30 |
| IUPAC Name | 1-[8-(4-fluorophenyl)-11a-methyl-4-(2-oxopentyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-3-yl]pentan-2-one |
| SMILES | CCCC(=O)CC1CC=C2C(CCC3=Cc4c(cnn4-c4ccc(F)cc4)CC32C)C1CC(=O)CCC |
| InChI | InChI=1S/C32H39FN2O2/c1-4-6-26(36)16-21-8-15-30-28(29(21)18-27(37)7-5-2)14-9-23-17-31-22(19-32(23,30)3)20-34-35(31)25-12-10-24(33)11-13-25/h10-13,15,17,20-21,28-29H,4-9,14,16,18-19H2,1-3H3 |
| InChIKey | WOYPKTDHCODCOV-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.67 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|