C24H24F4N2 — CID 90966506
(3R,4R,4aR,11aS)-8-(4-fluorophenyl)-4,11a-dimethyl-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole (PubChem CID 90966506) has the molecular formula C24H24F4N2 and a molecular weight of 416.46 g/mol. Its IUPAC name is (3R,4R,4aR,11aS)-8-(4-fluorophenyl)-4,11a-dimethyl-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole.
| Compound Name | (3R,4R,4aR,11aS)-8-(4-fluorophenyl)-4,11a-dimethyl-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole |
|---|---|
| PubChem CID | 90966506 |
| Molecular Formula | C24H24F4N2 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | (3R,4R,4aR,11aS)-8-(4-fluorophenyl)-4,11a-dimethyl-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole |
| SMILES | C[C@H]1[C@H](C(F)(F)F)CC=C2[C@@H]1CCC1=Cc3c(cnn3-c3ccc(F)cc3)C[C@@]12C |
| InChI | InChI=1S/C24H24F4N2/c1-14-19-8-3-16-11-22-15(13-29-30(22)18-6-4-17(25)5-7-18)12-23(16,2)21(19)10-9-20(14)24(26,27)28/h4-7,10-11,13-14,19-20H,3,8-9,12H2,1-2H3/t14-,19-,20-,23+/m1/s1 |
| InChIKey | HYFLDCNVBFFFQA-QHGLLYDTSA-N |
| XLogP | 6.51 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|