C28H32F3N3O — CID 142877041
N-[(3R,4R,4aS,11aS)-11a-methyl-8-(4-methylphenyl)-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-4-yl]-2-methylpropanamide (PubChem CID 142877041) has the molecular formula C28H32F3N3O and a molecular weight of 483.58 g/mol. Its IUPAC name is N-[(3R,4R,4aS,11aS)-11a-methyl-8-(4-methylphenyl)-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-4-yl]-2-methylpropanamide.
| Compound Name | N-[(3R,4R,4aS,11aS)-11a-methyl-8-(4-methylphenyl)-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-4-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 142877041 |
| Molecular Formula | C28H32F3N3O |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.25 |
| IUPAC Name | N-[(3R,4R,4aS,11aS)-11a-methyl-8-(4-methylphenyl)-3-(trifluoromethyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazol-4-yl]-2-methylpropanamide |
| SMILES | Cc1ccc(-n2ncc3c2C=C2CC[C@H]4C(=CC[C@@H](C(F)(F)F)[C@@H]4NC(=O)C(C)C)[C@@]2(C)C3)cc1 |
| InChI | InChI=1S/C28H32F3N3O/c1-16(2)26(35)33-25-21-10-7-19-13-24-18(15-32-34(24)20-8-5-17(3)6-9-20)14-27(19,4)22(21)11-12-23(25)28(29,30)31/h5-6,8-9,11,13,15-16,21,23,25H,7,10,12,14H2,1-4H3,(H,33,35)/t21-,23+,25+,27-/m0/s1 |
| InChIKey | VSWOZTFHSNAOCQ-BBVYRSAVSA-N |
| XLogP | 6.19 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|