C27H27FN2O4 — CID 10004534
(11'aS)-8'-(4-fluorophenyl)-2,2,11'a-trimethylspiro[1,3-dioxane-5,4'-2,3,4a,5,6,11-hexahydronaphtho[1,2-f]indazole]-4,6-dione (PubChem CID 10004534) has the molecular formula C27H27FN2O4 and a molecular weight of 462.52 g/mol. Its IUPAC name is (11'aS)-8'-(4-fluorophenyl)-2,2,11'a-trimethylspiro[1,3-dioxane-5,4'-2,3,4a,5,6,11-hexahydronaphtho[1,2-f]indazole]-4,6-dione.
| Compound Name | (11'aS)-8'-(4-fluorophenyl)-2,2,11'a-trimethylspiro[1,3-dioxane-5,4'-2,3,4a,5,6,11-hexahydronaphtho[1,2-f]indazole]-4,6-dione |
|---|---|
| PubChem CID | 10004534 |
| Molecular Formula | C27H27FN2O4 |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | (11'aS)-8'-(4-fluorophenyl)-2,2,11'a-trimethylspiro[1,3-dioxane-5,4'-2,3,4a,5,6,11-hexahydronaphtho[1,2-f]indazole]-4,6-dione |
| SMILES | CC1(C)OC(=O)C2(CCC=C3C2CCC2=Cc4c(cnn4-c4ccc(F)cc4)C[C@@]23C)C(=O)O1 |
| InChI | InChI=1S/C27H27FN2O4/c1-25(2)33-23(31)27(24(32)34-25)12-4-5-20-21(27)11-6-17-13-22-16(14-26(17,20)3)15-29-30(22)19-9-7-18(28)8-10-19/h5,7-10,13,15,21H,4,6,11-12,14H2,1-3H3/t21?,26-/m0/s1 |
| InChIKey | YYZDPICFHGASBR-UQTORGHUSA-N |
| XLogP | 4.91 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|