C27H26F4N2O4 — CID 91236459
(3S,4S,4aR,11aS)-8-(4-fluorophenyl)-10,11,11a-trimethyl-3-(trifluoromethoxycarbonyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole-4-carboxylic acid (PubChem CID 91236459) has the molecular formula C27H26F4N2O4 and a molecular weight of 518.51 g/mol. Its IUPAC name is (3S,4S,4aR,11aS)-8-(4-fluorophenyl)-10,11,11a-trimethyl-3-(trifluoromethoxycarbonyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole-4-carboxylic acid.
| Compound Name | (3S,4S,4aR,11aS)-8-(4-fluorophenyl)-10,11,11a-trimethyl-3-(trifluoromethoxycarbonyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole-4-carboxylic acid |
|---|---|
| PubChem CID | 91236459 |
| Molecular Formula | C27H26F4N2O4 |
| Molecular Weight | 518.51 g/mol |
| Exact Mass | 518.18 |
| IUPAC Name | (3S,4S,4aR,11aS)-8-(4-fluorophenyl)-10,11,11a-trimethyl-3-(trifluoromethoxycarbonyl)-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole-4-carboxylic acid |
| SMILES | Cc1nn(-c2ccc(F)cc2)c2c1C(C)[C@@]1(C)C(=C2)CC[C@H]2C1=CC[C@H](C(=O)OC(F)(F)F)[C@H]2C(=O)O |
| InChI | InChI=1S/C27H26F4N2O4/c1-13-22-14(2)32-33(17-7-5-16(28)6-8-17)21(22)12-15-4-9-18-20(26(13,15)3)11-10-19(23(18)24(34)35)25(36)37-27(29,30)31/h5-8,11-13,18-19,23H,4,9-10H2,1-3H3,(H,34,35)/t13?,18-,19-,23-,26-/m0/s1 |
| InChIKey | RNDWACXVLSOZHO-MLFNXFRLSA-N |
| XLogP | 5.95 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.51 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|