C25H24F4N2O2 — CID 90914898
trifluoromethyl (4aR,11aS)-8-(4-fluorophenyl)-10,11a-dimethyl-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole-4-carboxylate (PubChem CID 90914898) has the molecular formula C25H24F4N2O2 and a molecular weight of 460.47 g/mol. Its IUPAC name is trifluoromethyl (4aR,11aS)-8-(4-fluorophenyl)-10,11a-dimethyl-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole-4-carboxylate.
| Compound Name | trifluoromethyl (4aR,11aS)-8-(4-fluorophenyl)-10,11a-dimethyl-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole-4-carboxylate |
|---|---|
| PubChem CID | 90914898 |
| Molecular Formula | C25H24F4N2O2 |
| Molecular Weight | 460.47 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | trifluoromethyl (4aR,11aS)-8-(4-fluorophenyl)-10,11a-dimethyl-3,4,4a,5,6,11-hexahydro-2H-naphtho[1,2-f]indazole-4-carboxylate |
| SMILES | Cc1nn(-c2ccc(F)cc2)c2c1C[C@@]1(C)C(=C2)CC[C@H]2C1=CCCC2C(=O)OC(F)(F)F |
| InChI | InChI=1S/C25H24F4N2O2/c1-14-20-13-24(2)15(12-22(20)31(30-14)17-9-7-16(26)8-10-17)6-11-18-19(4-3-5-21(18)24)23(32)33-25(27,28)29/h5,7-10,12,18-19H,3-4,6,11,13H2,1-2H3/t18-,19?,24+/m1/s1 |
| InChIKey | LGCLBQOMARPYSQ-IIUALNLXSA-N |
| XLogP | 6.08 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.47 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|