C9H8N2OS — CID 139374180
2-(2-methyl-1,3-thiazol-5-yl)-1H-pyridin-4-one (PubChem CID 139374180) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-(2-methyl-1,3-thiazol-5-yl)-1H-pyridin-4-one.
| Compound Name | 2-(2-methyl-1,3-thiazol-5-yl)-1H-pyridin-4-one |
|---|---|
| PubChem CID | 139374180 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 2-(2-methyl-1,3-thiazol-5-yl)-1H-pyridin-4-one |
| SMILES | Cc1ncc(-c2cc(=O)cc[nH]2)s1 |
| InChI | InChI=1S/C9H8N2OS/c1-6-11-5-9(13-6)8-4-7(12)2-3-10-8/h2-5H,1H3,(H,10,12) |
| InChIKey | AOUVNZQCWWRKLF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |