C20H18F3N3O4 — CID 139382320
(E)-N-hydroxy-3-[2-[2-oxo-3-[[3-(trifluoromethoxy)phenyl]methyl]imidazolidin-1-yl]phenyl]prop-2-enamide (PubChem CID 139382320) has the molecular formula C20H18F3N3O4 and a molecular weight of 421.38 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[2-[2-oxo-3-[[3-(trifluoromethoxy)phenyl]methyl]imidazolidin-1-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[2-[2-oxo-3-[[3-(trifluoromethoxy)phenyl]methyl]imidazolidin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 139382320 |
| Molecular Formula | C20H18F3N3O4 |
| Molecular Weight | 421.38 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (E)-N-hydroxy-3-[2-[2-oxo-3-[[3-(trifluoromethoxy)phenyl]methyl]imidazolidin-1-yl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1N1CCN(Cc2cccc(OC(F)(F)F)c2)C1=O)NO |
| InChI | InChI=1S/C20H18F3N3O4/c21-20(22,23)30-16-6-3-4-14(12-16)13-25-10-11-26(19(25)28)17-7-2-1-5-15(17)8-9-18(27)24-29/h1-9,12,29H,10-11,13H2,(H,24,27)/b9-8+ |
| InChIKey | WZOSDDZJZNZKIN-CMDGGOBGSA-N |
| XLogP | 3.55 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|