C20H18F3N3O5S — CID 166920874
(E)-N-hydroxy-3-[2-[2-oxo-4-[4-(trifluoromethoxy)phenyl]sulfinylpiperazin-1-yl]phenyl]prop-2-enamide (PubChem CID 166920874) has the molecular formula C20H18F3N3O5S and a molecular weight of 469.44 g/mol. Its IUPAC name is (E)-N-hydroxy-3-[2-[2-oxo-4-[4-(trifluoromethoxy)phenyl]sulfinylpiperazin-1-yl]phenyl]prop-2-enamide.
| Compound Name | (E)-N-hydroxy-3-[2-[2-oxo-4-[4-(trifluoromethoxy)phenyl]sulfinylpiperazin-1-yl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166920874 |
| Molecular Formula | C20H18F3N3O5S |
| Molecular Weight | 469.44 g/mol |
| Exact Mass | 469.09 |
| IUPAC Name | (E)-N-hydroxy-3-[2-[2-oxo-4-[4-(trifluoromethoxy)phenyl]sulfinylpiperazin-1-yl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1N1CCN(S(=O)c2ccc(OC(F)(F)F)cc2)CC1=O)NO |
| InChI | InChI=1S/C20H18F3N3O5S/c21-20(22,23)31-15-6-8-16(9-7-15)32(30)25-11-12-26(19(28)13-25)17-4-2-1-3-14(17)5-10-18(27)24-29/h1-10,29H,11-13H2,(H,24,27)/b10-5+ |
| InChIKey | CXLKFQNMWHSDHA-BJMVGYQFSA-N |
| XLogP | 2.48 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|