C17H14ClF3N2O — CID 139382710
N-[7-chloro-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]formamide (PubChem CID 139382710) has the molecular formula C17H14ClF3N2O and a molecular weight of 354.76 g/mol. Its IUPAC name is N-[7-chloro-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]formamide.
| Compound Name | N-[7-chloro-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]formamide |
|---|---|
| PubChem CID | 139382710 |
| Molecular Formula | C17H14ClF3N2O |
| Molecular Weight | 354.76 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | N-[7-chloro-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindol-5-yl]formamide |
| SMILES | O=CNc1cc(Cl)c2c(c1)CCN2Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14ClF3N2O/c18-15-8-14(22-10-24)7-12-4-5-23(16(12)15)9-11-2-1-3-13(6-11)17(19,20)21/h1-3,6-8,10H,4-5,9H2,(H,22,24) |
| InChIKey | UMOPDXSJOAAKEV-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.76 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|