C16H12ClF3N2O2 — CID 139382876
7-chloro-5-nitro-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindole (PubChem CID 139382876) has the molecular formula C16H12ClF3N2O2 and a molecular weight of 356.73 g/mol. Its IUPAC name is 7-chloro-5-nitro-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindole.
| Compound Name | 7-chloro-5-nitro-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindole |
|---|---|
| PubChem CID | 139382876 |
| Molecular Formula | C16H12ClF3N2O2 |
| Molecular Weight | 356.73 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 7-chloro-5-nitro-1-[[3-(trifluoromethyl)phenyl]methyl]-2,3-dihydroindole |
| SMILES | O=[N+]([O-])c1cc(Cl)c2c(c1)CCN2Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H12ClF3N2O2/c17-14-8-13(22(23)24)7-11-4-5-21(15(11)14)9-10-2-1-3-12(6-10)16(18,19)20/h1-3,6-8H,4-5,9H2 |
| InChIKey | DWGVBYUKPMAFLP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.73 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|