C15H14BrN3O2 — CID 103351376
1-[(3-bromo-5-nitrophenyl)methyl]-2,3-dihydroindol-7-amine (PubChem CID 103351376) has the molecular formula C15H14BrN3O2 and a molecular weight of 348.20 g/mol. Its IUPAC name is 1-[(3-bromo-5-nitrophenyl)methyl]-2,3-dihydroindol-7-amine.
| Compound Name | 1-[(3-bromo-5-nitrophenyl)methyl]-2,3-dihydroindol-7-amine |
|---|---|
| PubChem CID | 103351376 |
| Molecular Formula | C15H14BrN3O2 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 347.03 |
| IUPAC Name | 1-[(3-bromo-5-nitrophenyl)methyl]-2,3-dihydroindol-7-amine |
| SMILES | Nc1cccc2c1N(Cc1cc(Br)cc([N+](=O)[O-])c1)CC2 |
| InChI | InChI=1S/C15H14BrN3O2/c16-12-6-10(7-13(8-12)19(20)21)9-18-5-4-11-2-1-3-14(17)15(11)18/h1-3,6-8H,4-5,9,17H2 |
| InChIKey | KYQSGQVQMKDMBT-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|