C17H16BrN3O3 — CID 166335427
10-[(3-bromo-5-nitrophenyl)methyl]-4-oxa-1,10-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene (PubChem CID 166335427) has the molecular formula C17H16BrN3O3 and a molecular weight of 390.24 g/mol. Its IUPAC name is 10-[(3-bromo-5-nitrophenyl)methyl]-4-oxa-1,10-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene.
| Compound Name | 10-[(3-bromo-5-nitrophenyl)methyl]-4-oxa-1,10-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
|---|---|
| PubChem CID | 166335427 |
| Molecular Formula | C17H16BrN3O3 |
| Molecular Weight | 390.24 g/mol |
| Exact Mass | 389.04 |
| IUPAC Name | 10-[(3-bromo-5-nitrophenyl)methyl]-4-oxa-1,10-diazatricyclo[7.3.1.05,13]trideca-5,7,9(13)-triene |
| SMILES | O=[N+]([O-])c1cc(Br)cc(CN2CCN3CCOc4cccc2c43)c1 |
| InChI | InChI=1S/C17H16BrN3O3/c18-13-8-12(9-14(10-13)21(22)23)11-20-5-4-19-6-7-24-16-3-1-2-15(20)17(16)19/h1-3,8-10H,4-7,11H2 |
| InChIKey | XEXREKFKWSKSSO-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.24 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|