C15H26O5 — CID 139393103
[1-(1,3-dihydroxycyclohexyl)-4-hydroxy-2-methylbutan-2-yl] 2-methylprop-2-enoate (PubChem CID 139393103) has the molecular formula C15H26O5 and a molecular weight of 286.37 g/mol. Its IUPAC name is [1-(1,3-dihydroxycyclohexyl)-4-hydroxy-2-methylbutan-2-yl] 2-methylprop-2-enoate.
| Compound Name | [1-(1,3-dihydroxycyclohexyl)-4-hydroxy-2-methylbutan-2-yl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139393103 |
| Molecular Formula | C15H26O5 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [1-(1,3-dihydroxycyclohexyl)-4-hydroxy-2-methylbutan-2-yl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(C)(CCO)CC1(O)CCCC(O)C1 |
| InChI | InChI=1S/C15H26O5/c1-11(2)13(18)20-14(3,7-8-16)10-15(19)6-4-5-12(17)9-15/h12,16-17,19H,1,4-10H2,2-3H3 |
| InChIKey | FLUZBJCFUBEOLO-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|