C17H15FO3 — CID 139404366
1-(4-fluorophenyl)-5,6-dihydroxy-7-methyl-2,3-dihydro-1H-indene-4-carbaldehyde (PubChem CID 139404366) has the molecular formula C17H15FO3 and a molecular weight of 286.30 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-5,6-dihydroxy-7-methyl-2,3-dihydro-1H-indene-4-carbaldehyde.
| Compound Name | 1-(4-fluorophenyl)-5,6-dihydroxy-7-methyl-2,3-dihydro-1H-indene-4-carbaldehyde |
|---|---|
| PubChem CID | 139404366 |
| Molecular Formula | C17H15FO3 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 1-(4-fluorophenyl)-5,6-dihydroxy-7-methyl-2,3-dihydro-1H-indene-4-carbaldehyde |
| SMILES | Cc1c(O)c(O)c(C=O)c2c1C(c1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C17H15FO3/c1-9-15-12(10-2-4-11(18)5-3-10)6-7-13(15)14(8-19)17(21)16(9)20/h2-5,8,12,20-21H,6-7H2,1H3 |
| InChIKey | MGVSMMJPRCHOGS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|