C22H26FN2O3+ — CID 139417920
4-[2-[2-fluoro-4-[3-(4-hydroxymorpholin-4-ium-4-yl)propoxy]phenyl]ethynyl]-N-methylaniline (PubChem CID 139417920) has the molecular formula C22H26FN2O3+ and a molecular weight of 385.46 g/mol. Its IUPAC name is 4-[2-[2-fluoro-4-[3-(4-hydroxymorpholin-4-ium-4-yl)propoxy]phenyl]ethynyl]-N-methylaniline.
| Compound Name | 4-[2-[2-fluoro-4-[3-(4-hydroxymorpholin-4-ium-4-yl)propoxy]phenyl]ethynyl]-N-methylaniline |
|---|---|
| PubChem CID | 139417920 |
| Molecular Formula | C22H26FN2O3+ |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | 4-[2-[2-fluoro-4-[3-(4-hydroxymorpholin-4-ium-4-yl)propoxy]phenyl]ethynyl]-N-methylaniline |
| SMILES | CNc1ccc(C#Cc2ccc(OCCC[N+]3(O)CCOCC3)cc2F)cc1 |
| InChI | InChI=1S/C22H26FN2O3/c1-24-20-8-4-18(5-9-20)3-6-19-7-10-21(17-22(19)23)28-14-2-11-25(26)12-15-27-16-13-25/h4-5,7-10,17,24,26H,2,11-16H2,1H3/q+1 |
| InChIKey | KSRGEDBJKQVITN-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|